C16H33N2O3P — CID 102420547
(1R,2R,4S)-2-N-(2-diethoxyphosphorylethyl)-1-methyl-4-prop-1-en-2-ylcyclohexane-1,2-diamine (PubChem CID 102420547) has the molecular formula C16H33N2O3P and a molecular weight of 332.43 g/mol. Its IUPAC name is (1R,2R,4S)-2-N-(2-diethoxyphosphorylethyl)-1-methyl-4-prop-1-en-2-ylcyclohexane-1,2-diamine.
| Compound Name | (1R,2R,4S)-2-N-(2-diethoxyphosphorylethyl)-1-methyl-4-prop-1-en-2-ylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 102420547 |
| Molecular Formula | C16H33N2O3P |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | (1R,2R,4S)-2-N-(2-diethoxyphosphorylethyl)-1-methyl-4-prop-1-en-2-ylcyclohexane-1,2-diamine |
| SMILES | C=C(C)[C@H]1CC[C@@](C)(N)[C@H](NCCP(=O)(OCC)OCC)C1 |
| InChI | InChI=1S/C16H33N2O3P/c1-6-20-22(19,21-7-2)11-10-18-15-12-14(13(3)4)8-9-16(15,5)17/h14-15,18H,3,6-12,17H2,1-2,4-5H3/t14-,15+,16+/m0/s1 |
| InChIKey | GEIJNECEADCWGX-ARFHVFGLSA-N |
| XLogP | 3.30 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|