C17H26N2O2S — CID 102100745
N-[(1S,2S,5R)-2-amino-2-methyl-5-prop-1-en-2-ylcyclohexyl]-4-methylbenzenesulfonamide (PubChem CID 102100745) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is N-[(1S,2S,5R)-2-amino-2-methyl-5-prop-1-en-2-ylcyclohexyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,2S,5R)-2-amino-2-methyl-5-prop-1-en-2-ylcyclohexyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102100745 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-[(1S,2S,5R)-2-amino-2-methyl-5-prop-1-en-2-ylcyclohexyl]-4-methylbenzenesulfonamide |
| SMILES | C=C(C)[C@@H]1CC[C@](C)(N)[C@@H](NS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C17H26N2O2S/c1-12(2)14-9-10-17(4,18)16(11-14)19-22(20,21)15-7-5-13(3)6-8-15/h5-8,14,16,19H,1,9-11,18H2,2-4H3/t14-,16+,17+/m1/s1 |
| InChIKey | QQMIWMPPWUKWSQ-PVAVHDDUSA-N |
| XLogP | 2.74 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|