C18H25NO3S — CID 15529692
4-methyl-N-[(6S,11S)-5-oxospiro[5.5]undecan-11-yl]benzenesulfonamide (PubChem CID 15529692) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is 4-methyl-N-[(6S,11S)-5-oxospiro[5.5]undecan-11-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(6S,11S)-5-oxospiro[5.5]undecan-11-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 15529692 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 4-methyl-N-[(6S,11S)-5-oxospiro[5.5]undecan-11-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2CCCC[C@]23CCCCC3=O)cc1 |
| InChI | InChI=1S/C18H25NO3S/c1-14-8-10-15(11-9-14)23(21,22)19-16-6-2-4-12-18(16)13-5-3-7-17(18)20/h8-11,16,19H,2-7,12-13H2,1H3/t16-,18-/m0/s1 |
| InChIKey | SKGGECSKIPDFIE-WMZOPIPTSA-N |
| XLogP | 3.35 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |