C19H21NO3S — CID 15529713
N-[(1S,2S)-2-formyl-2-phenylcyclopentyl]-4-methylbenzenesulfonamide (PubChem CID 15529713) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-[(1S,2S)-2-formyl-2-phenylcyclopentyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,2S)-2-formyl-2-phenylcyclopentyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 15529713 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-[(1S,2S)-2-formyl-2-phenylcyclopentyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2CCC[C@]2(C=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H21NO3S/c1-15-9-11-17(12-10-15)24(22,23)20-18-8-5-13-19(18,14-21)16-6-3-2-4-7-16/h2-4,6-7,9-12,14,18,20H,5,8,13H2,1H3/t18-,19-/m0/s1 |
| InChIKey | RLUIRYFOZWSXNE-OALUTQOASA-N |
| XLogP | 2.96 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|