C20H25NO3S — CID 101495725
N-[(1R,2S,3R)-3-methoxy-2-phenylcyclohexyl]-4-methylbenzenesulfonamide (PubChem CID 101495725) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is N-[(1R,2S,3R)-3-methoxy-2-phenylcyclohexyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R,2S,3R)-3-methoxy-2-phenylcyclohexyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101495725 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[(1R,2S,3R)-3-methoxy-2-phenylcyclohexyl]-4-methylbenzenesulfonamide |
| SMILES | CO[C@@H]1CCC[C@@H](NS(=O)(=O)c2ccc(C)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H25NO3S/c1-15-11-13-17(14-12-15)25(22,23)21-18-9-6-10-19(24-2)20(18)16-7-4-3-5-8-16/h3-5,7-8,11-14,18-21H,6,9-10H2,1-2H3/t18-,19-,20+/m1/s1 |
| InChIKey | VAXBRYDPDSRXRI-AQNXPRMDSA-N |
| XLogP | 3.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |