C18H21NO2S2 — CID 11544772
4-methyl-N-[(1R,2R)-2-phenylsulfanylcyclopentyl]benzenesulfonamide (PubChem CID 11544772) has the molecular formula C18H21NO2S2 and a molecular weight of 347.51 g/mol. Its IUPAC name is 4-methyl-N-[(1R,2R)-2-phenylsulfanylcyclopentyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1R,2R)-2-phenylsulfanylcyclopentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11544772 |
| Molecular Formula | C18H21NO2S2 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-methyl-N-[(1R,2R)-2-phenylsulfanylcyclopentyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCC[C@H]2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NO2S2/c1-14-10-12-16(13-11-14)23(20,21)19-17-8-5-9-18(17)22-15-6-3-2-4-7-15/h2-4,6-7,10-13,17-19H,5,8-9H2,1H3/t17-,18-/m1/s1 |
| InChIKey | OFAZAXMVTDKVDV-QZTJIDSGSA-N |
| XLogP | 3.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |