C21H30N2O2RuS — CID 87832086
N-[(1R,2R)-2-aminocyclohexyl]-4-methylbenzenesulfonamide;ruthenium;1,2-xylene (PubChem CID 87832086) has the molecular formula C21H30N2O2RuS and a molecular weight of 475.62 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-4-methylbenzenesulfonamide;ruthenium;1,2-xylene.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-4-methylbenzenesulfonamide;ruthenium;1,2-xylene |
|---|---|
| PubChem CID | 87832086 |
| Molecular Formula | C21H30N2O2RuS |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-4-methylbenzenesulfonamide;ruthenium;1,2-xylene |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2N)cc1.Cc1ccccc1C.[Ru] |
| InChI | InChI=1S/C13H20N2O2S.C8H10.Ru/c1-10-6-8-11(9-7-10)18(16,17)15-13-5-3-2-4-12(13)14;1-7-5-3-4-6-8(7)2;/h6-9,12-13,15H,2-5,14H2,1H3;3-6H,1-2H3;/t12-,13-;;/m1../s1 |
| InChIKey | YNAIOUFVXPXMHC-SNFSYSBXSA-N |
| XLogP | 3.84 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |