C18H25NO6S — CID 53384267
dimethyl 2-[2-[(4-methylphenyl)sulfonylamino]cyclohexyl]propanedioate (PubChem CID 53384267) has the molecular formula C18H25NO6S and a molecular weight of 383.47 g/mol. Its IUPAC name is dimethyl 2-[2-[(4-methylphenyl)sulfonylamino]cyclohexyl]propanedioate.
| Compound Name | dimethyl 2-[2-[(4-methylphenyl)sulfonylamino]cyclohexyl]propanedioate |
|---|---|
| PubChem CID | 53384267 |
| Molecular Formula | C18H25NO6S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | dimethyl 2-[2-[(4-methylphenyl)sulfonylamino]cyclohexyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C1CCCCC1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H25NO6S/c1-12-8-10-13(11-9-12)26(22,23)19-15-7-5-4-6-14(15)16(17(20)24-2)18(21)25-3/h8-11,14-16,19H,4-7H2,1-3H3 |
| InChIKey | BZTHIAPESWQGNZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|