C21H25NO4S — CID 132517688
[(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 4-methylbenzoate (PubChem CID 132517688) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 4-methylbenzoate.
| Compound Name | [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 132517688 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@@H]2CCCC[C@H]2NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H25NO4S/c1-15-7-11-17(12-8-15)21(23)26-20-6-4-3-5-19(20)22-27(24,25)18-13-9-16(2)10-14-18/h7-14,19-20,22H,3-6H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | BHLWOGRFQKCQTO-WOJBJXKFSA-N |
| XLogP | 3.75 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |