C16H21NO4S — CID 139224223
[(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] prop-2-enoate (PubChem CID 139224223) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] prop-2-enoate.
| Compound Name | [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] prop-2-enoate |
|---|---|
| PubChem CID | 139224223 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@H]1CCCC[C@H]1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H21NO4S/c1-3-16(18)21-15-7-5-4-6-14(15)17-22(19,20)13-10-8-12(2)9-11-13/h3,8-11,14-15,17H,1,4-7H2,2H3/t14-,15-/m1/s1 |
| InChIKey | YRHOPERCNRLLGK-HUUCEWRRSA-N |
| XLogP | 2.31 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|