C20H22ClNO4S — CID 102181251
[(1S,2S)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 2-chlorobenzoate (PubChem CID 102181251) has the molecular formula C20H22ClNO4S and a molecular weight of 407.92 g/mol. Its IUPAC name is [(1S,2S)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 2-chlorobenzoate.
| Compound Name | [(1S,2S)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 102181251 |
| Molecular Formula | C20H22ClNO4S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | [(1S,2S)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] 2-chlorobenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2CCCC[C@@H]2OC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H22ClNO4S/c1-14-10-12-15(13-11-14)27(24,25)22-18-8-4-5-9-19(18)26-20(23)16-6-2-3-7-17(16)21/h2-3,6-7,10-13,18-19,22H,4-5,8-9H2,1H3/t18-,19-/m0/s1 |
| InChIKey | KWLHIGOQNBHLAP-OALUTQOASA-N |
| XLogP | 4.09 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |