About [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] (E)-3-phenylprop-2-enoate
[(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] (E)-3-phenylprop-2-enoate (PubChem CID 132517677) has the molecular formula C22H25NO4S
and a molecular weight of 399.51 g/mol. Its IUPAC name is [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] (E)-3-phenylprop-2-enoate |
| PubChem CID | 132517677 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] (E)-3-phenylprop-2-enoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2OC(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C22H25NO4S/c1-17-11-14-19(15-12-17)28(25,26)23-20-9-5-6-10-21(20)27-22(24)16-13-18-7-3-2-4-8-18/h2-4,7-8,11-16,20-21,23H,5-6,9-10H2,1H3/b16-13+/t20-,21-/m1/s1 |
| InChIKey | CJOPHCUMIXUPBX-UZAOCVSLSA-N |
| XLogP | 3.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] (E)-3-phenylprop-2-enoate?
The IUPAC name of [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] (E)-3-phenylprop-2-enoate (CID 132517677) is [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] (E)-3-phenylprop-2-enoate.
What is the SMILES notation for [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] (E)-3-phenylprop-2-enoate?
The canonical SMILES for [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] (E)-3-phenylprop-2-enoate is Cc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2OC(=O)/C=C/c2ccccc2)cc1.
What is the InChIKey of [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] (E)-3-phenylprop-2-enoate?
The InChIKey is CJOPHCUMIXUPBX-UZAOCVSLSA-N. The full InChI is InChI=1S/C22H25NO4S/c1-17-11-14-19(15-12-17)28(25,26)23-20-9-5-6-10-21(20)27-22(24)16-13-18-7-3-2-4-8-18/h2-4,7-8,11-16,20-21,23H,5-6,9-10H2,1H3/b16-13+/t20-,21-/m1/s1.
What are the key properties of [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] (E)-3-phenylprop-2-enoate?
[(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] (E)-3-phenylprop-2-enoate has a molecular weight of 399.51 g/mol, XLogP of 3.84, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl] (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 132517677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).