C21H28NO4PS — CID 134848300
N-[(1S,2S)-2-[ethyl(phenyl)phosphoryl]oxycyclohexyl]-4-methylbenzenesulfonamide (PubChem CID 134848300) has the molecular formula C21H28NO4PS and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[(1S,2S)-2-[ethyl(phenyl)phosphoryl]oxycyclohexyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,2S)-2-[ethyl(phenyl)phosphoryl]oxycyclohexyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134848300 |
| Molecular Formula | C21H28NO4PS |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-[(1S,2S)-2-[ethyl(phenyl)phosphoryl]oxycyclohexyl]-4-methylbenzenesulfonamide |
| SMILES | CC[P@@](=O)(O[C@H]1CCCC[C@@H]1NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H28NO4PS/c1-3-27(23,18-9-5-4-6-10-18)26-21-12-8-7-11-20(21)22-28(24,25)19-15-13-17(2)14-16-19/h4-6,9-10,13-16,20-22H,3,7-8,11-12H2,1-2H3/t20-,21-,27+/m0/s1 |
| InChIKey | KZHRIFRHTGSDND-NOMHHCBYSA-N |
| XLogP | 4.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|