C17H25NO3S — CID 134926580
4-methyl-N-[(1S,2S)-2-methyl-2-propanoylcyclohexyl]benzenesulfonamide (PubChem CID 134926580) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 4-methyl-N-[(1S,2S)-2-methyl-2-propanoylcyclohexyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(1S,2S)-2-methyl-2-propanoylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134926580 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 4-methyl-N-[(1S,2S)-2-methyl-2-propanoylcyclohexyl]benzenesulfonamide |
| SMILES | CCC(=O)[C@@]1(C)CCCC[C@@H]1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H25NO3S/c1-4-16(19)17(3)12-6-5-7-15(17)18-22(20,21)14-10-8-13(2)9-11-14/h8-11,15,18H,4-7,12H2,1-3H3/t15-,17-/m0/s1 |
| InChIKey | XHJKIUWOBGZCRW-RDJZCZTQSA-N |
| XLogP | 3.20 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |