C14H18FNO4S — CID 82763507
2-[(2-fluoro-5-methylphenyl)sulfonylamino]-1-methylcyclopentane-1-carboxylic acid (PubChem CID 82763507) has the molecular formula C14H18FNO4S and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-[(2-fluoro-5-methylphenyl)sulfonylamino]-1-methylcyclopentane-1-carboxylic acid.
| Compound Name | 2-[(2-fluoro-5-methylphenyl)sulfonylamino]-1-methylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 82763507 |
| Molecular Formula | C14H18FNO4S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[(2-fluoro-5-methylphenyl)sulfonylamino]-1-methylcyclopentane-1-carboxylic acid |
| SMILES | Cc1ccc(F)c(S(=O)(=O)NC2CCCC2(C)C(=O)O)c1 |
| InChI | InChI=1S/C14H18FNO4S/c1-9-5-6-10(15)11(8-9)21(19,20)16-12-4-3-7-14(12,2)13(17)18/h5-6,8,12,16H,3-4,7H2,1-2H3,(H,17,18) |
| InChIKey | JPPLWQUKVRYZCL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |