C17H27NO2S — CID 134950538
N-[(3R)-3-ethyl-4,4-dimethylcyclohexyl]-4-methylbenzenesulfonamide (PubChem CID 134950538) has the molecular formula C17H27NO2S and a molecular weight of 309.48 g/mol. Its IUPAC name is N-[(3R)-3-ethyl-4,4-dimethylcyclohexyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(3R)-3-ethyl-4,4-dimethylcyclohexyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134950538 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | N-[(3R)-3-ethyl-4,4-dimethylcyclohexyl]-4-methylbenzenesulfonamide |
| SMILES | CC[C@@H]1CC(NS(=O)(=O)c2ccc(C)cc2)CCC1(C)C |
| InChI | InChI=1S/C17H27NO2S/c1-5-14-12-15(10-11-17(14,3)4)18-21(19,20)16-8-6-13(2)7-9-16/h6-9,14-15,18H,5,10-12H2,1-4H3/t14-,15?/m1/s1 |
| InChIKey | STQCXHATNSVLCJ-GICMACPYSA-N |
| XLogP | 3.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |