C16H22F3NO3S — CID 164862828
4-(trifluoromethoxy)-N-(3,4,4-trimethylcyclohexyl)benzenesulfonamide (PubChem CID 164862828) has the molecular formula C16H22F3NO3S and a molecular weight of 365.42 g/mol. Its IUPAC name is 4-(trifluoromethoxy)-N-(3,4,4-trimethylcyclohexyl)benzenesulfonamide.
| Compound Name | 4-(trifluoromethoxy)-N-(3,4,4-trimethylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 164862828 |
| Molecular Formula | C16H22F3NO3S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 4-(trifluoromethoxy)-N-(3,4,4-trimethylcyclohexyl)benzenesulfonamide |
| SMILES | CC1CC(NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)CCC1(C)C |
| InChI | InChI=1S/C16H22F3NO3S/c1-11-10-12(8-9-15(11,2)3)20-24(21,22)14-6-4-13(5-7-14)23-16(17,18)19/h4-7,11-12,20H,8-10H2,1-3H3 |
| InChIKey | GVDHBFNZIGBEGQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |