C20H22F3NO4S — CID 45278732
N-(4-hydroxycyclohexyl)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzenesulfonamide (PubChem CID 45278732) has the molecular formula C20H22F3NO4S and a molecular weight of 429.46 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzenesulfonamide.
| Compound Name | N-(4-hydroxycyclohexyl)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 45278732 |
| Molecular Formula | C20H22F3NO4S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-3-methyl-4-[4-(trifluoromethoxy)phenyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCC(O)CC2)ccc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H22F3NO4S/c1-13-12-18(29(26,27)24-15-4-6-16(25)7-5-15)10-11-19(13)14-2-8-17(9-3-14)28-20(21,22)23/h2-3,8-12,15-16,24-25H,4-7H2,1H3 |
| InChIKey | JVJMPVSYGSZYEC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |