C13H15BrF3NO4S — CID 146411611
5-bromo-N-(4-hydroxycyclohexyl)-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 146411611) has the molecular formula C13H15BrF3NO4S and a molecular weight of 418.23 g/mol. Its IUPAC name is 5-bromo-N-(4-hydroxycyclohexyl)-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 5-bromo-N-(4-hydroxycyclohexyl)-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 146411611 |
| Molecular Formula | C13H15BrF3NO4S |
| Molecular Weight | 418.23 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | 5-bromo-N-(4-hydroxycyclohexyl)-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCC(O)CC1)c1cc(Br)ccc1OC(F)(F)F |
| InChI | InChI=1S/C13H15BrF3NO4S/c14-8-1-6-11(22-13(15,16)17)12(7-8)23(20,21)18-9-2-4-10(19)5-3-9/h1,6-7,9-10,18-19H,2-5H2 |
| InChIKey | UZRZBNPSDUPQNS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |