C15H19BrF3NO3S — CID 24651368
5-bromo-2-ethoxy-N-[4-(trifluoromethyl)cyclohexyl]benzenesulfonamide (PubChem CID 24651368) has the molecular formula C15H19BrF3NO3S and a molecular weight of 430.29 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-[4-(trifluoromethyl)cyclohexyl]benzenesulfonamide.
| Compound Name | 5-bromo-2-ethoxy-N-[4-(trifluoromethyl)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24651368 |
| Molecular Formula | C15H19BrF3NO3S |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | 5-bromo-2-ethoxy-N-[4-(trifluoromethyl)cyclohexyl]benzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H19BrF3NO3S/c1-2-23-13-8-5-11(16)9-14(13)24(21,22)20-12-6-3-10(4-7-12)15(17,18)19/h5,8-10,12,20H,2-4,6-7H2,1H3 |
| InChIKey | QWZJSNCCZNJZEU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |