C16H26N2O2S — CID 114548187
N-(3,3-dimethylcyclopentyl)-4-(ethylaminomethyl)benzenesulfonamide (PubChem CID 114548187) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-4-(ethylaminomethyl)benzenesulfonamide.
| Compound Name | N-(3,3-dimethylcyclopentyl)-4-(ethylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114548187 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-4-(ethylaminomethyl)benzenesulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NC2CCC(C)(C)C2)cc1 |
| InChI | InChI=1S/C16H26N2O2S/c1-4-17-12-13-5-7-15(8-6-13)21(19,20)18-14-9-10-16(2,3)11-14/h5-8,14,17-18H,4,9-12H2,1-3H3 |
| InChIKey | HNQZFDFLLZUXRO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |