C18H24O2S — CID 11266702
1-methyl-4-[[(1R,5S)-2-methylidene-5-prop-1-en-2-ylcyclohexyl]methylsulfonyl]benzene (PubChem CID 11266702) has the molecular formula C18H24O2S and a molecular weight of 304.45 g/mol. Its IUPAC name is 1-methyl-4-[[(1R,5S)-2-methylidene-5-prop-1-en-2-ylcyclohexyl]methylsulfonyl]benzene.
| Compound Name | 1-methyl-4-[[(1R,5S)-2-methylidene-5-prop-1-en-2-ylcyclohexyl]methylsulfonyl]benzene |
|---|---|
| PubChem CID | 11266702 |
| Molecular Formula | C18H24O2S |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-methyl-4-[[(1R,5S)-2-methylidene-5-prop-1-en-2-ylcyclohexyl]methylsulfonyl]benzene |
| SMILES | C=C(C)[C@H]1CCC(=C)[C@H](CS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C18H24O2S/c1-13(2)16-8-7-15(4)17(11-16)12-21(19,20)18-9-5-14(3)6-10-18/h5-6,9-10,16-17H,1,4,7-8,11-12H2,2-3H3/t16-,17-/m0/s1 |
| InChIKey | POBHCAHVQTVHEX-IRXDYDNUSA-N |
| XLogP | 4.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|