C12H14O4S — CID 12592297
3-(4-methylphenyl)sulfonylprop-1-en-2-yl acetate (PubChem CID 12592297) has the molecular formula C12H14O4S and a molecular weight of 254.31 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonylprop-1-en-2-yl acetate.
| Compound Name | 3-(4-methylphenyl)sulfonylprop-1-en-2-yl acetate |
|---|---|
| PubChem CID | 12592297 |
| Molecular Formula | C12H14O4S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 3-(4-methylphenyl)sulfonylprop-1-en-2-yl acetate |
| SMILES | C=C(CS(=O)(=O)c1ccc(C)cc1)OC(C)=O |
| InChI | InChI=1S/C12H14O4S/c1-9-4-6-12(7-5-9)17(14,15)8-10(2)16-11(3)13/h4-7H,2,8H2,1,3H3 |
| InChIKey | ISYQLKRTJUUUEC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|