C25H36O6S — CID 150357429
10-(2-methylprop-2-enoyloxy)decyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate (PubChem CID 150357429) has the molecular formula C25H36O6S and a molecular weight of 464.62 g/mol. Its IUPAC name is 10-(2-methylprop-2-enoyloxy)decyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate.
| Compound Name | 10-(2-methylprop-2-enoyloxy)decyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate |
|---|---|
| PubChem CID | 150357429 |
| Molecular Formula | C25H36O6S |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 10-(2-methylprop-2-enoyloxy)decyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCOC(=O)C(=C)CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H36O6S/c1-20(2)24(26)30-17-11-9-7-5-6-8-10-12-18-31-25(27)22(4)19-32(28,29)23-15-13-21(3)14-16-23/h13-16H,1,4-12,17-19H2,2-3H3 |
| InChIKey | GVAHYFRPOVGYEJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|