C16H23NO6S2 — CID 23554070
4-[methyl-(4-methylphenyl)sulfonylsulfamoyl]butyl 2-methylprop-2-enoate (PubChem CID 23554070) has the molecular formula C16H23NO6S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-[methyl-(4-methylphenyl)sulfonylsulfamoyl]butyl 2-methylprop-2-enoate.
| Compound Name | 4-[methyl-(4-methylphenyl)sulfonylsulfamoyl]butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23554070 |
| Molecular Formula | C16H23NO6S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 4-[methyl-(4-methylphenyl)sulfonylsulfamoyl]butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCS(=O)(=O)N(C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H23NO6S2/c1-13(2)16(18)23-11-5-6-12-24(19,20)17(4)25(21,22)15-9-7-14(3)8-10-15/h7-10H,1,5-6,11-12H2,2-4H3 |
| InChIKey | OYIZBPGLENDCGQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|