C19H28O5S — CID 19745505
6-(4-hydroxy-3-propan-2-ylphenyl)sulfonylhexyl 2-methylprop-2-enoate (PubChem CID 19745505) has the molecular formula C19H28O5S and a molecular weight of 368.50 g/mol. Its IUPAC name is 6-(4-hydroxy-3-propan-2-ylphenyl)sulfonylhexyl 2-methylprop-2-enoate.
| Compound Name | 6-(4-hydroxy-3-propan-2-ylphenyl)sulfonylhexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 19745505 |
| Molecular Formula | C19H28O5S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 6-(4-hydroxy-3-propan-2-ylphenyl)sulfonylhexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCS(=O)(=O)c1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C19H28O5S/c1-14(2)17-13-16(9-10-18(17)20)25(22,23)12-8-6-5-7-11-24-19(21)15(3)4/h9-10,13-14,20H,3,5-8,11-12H2,1-2,4H3 |
| InChIKey | QTKLASJZGYRCLE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|