C28H44O4 — CID 67896874
butyl 2-methylprop-2-enoate;1-ethenyl-4-methylbenzene;hexyl 2-methylidenebutanoate (PubChem CID 67896874) has the molecular formula C28H44O4 and a molecular weight of 444.66 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;1-ethenyl-4-methylbenzene;hexyl 2-methylidenebutanoate.
| Compound Name | butyl 2-methylprop-2-enoate;1-ethenyl-4-methylbenzene;hexyl 2-methylidenebutanoate |
|---|---|
| PubChem CID | 67896874 |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | butyl 2-methylprop-2-enoate;1-ethenyl-4-methylbenzene;hexyl 2-methylidenebutanoate |
| SMILES | C=C(C)C(=O)OCCCC.C=C(CC)C(=O)OCCCCCC.C=Cc1ccc(C)cc1 |
| InChI | InChI=1S/C11H20O2.C9H10.C8H14O2/c1-4-6-7-8-9-13-11(12)10(3)5-2;1-3-9-6-4-8(2)5-7-9;1-4-5-6-10-8(9)7(2)3/h3-9H2,1-2H3;3-7H,1H2,2H3;2,4-6H2,1,3H3 |
| InChIKey | AMYFEZDUTAWSEN-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|