C15H28O2 — CID 88842326
hexyl 2-methylidenebutanoate;2-methylprop-1-ene (PubChem CID 88842326) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is hexyl 2-methylidenebutanoate;2-methylprop-1-ene.
| Compound Name | hexyl 2-methylidenebutanoate;2-methylprop-1-ene |
|---|---|
| PubChem CID | 88842326 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | hexyl 2-methylidenebutanoate;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=C(CC)C(=O)OCCCCCC |
| InChI | InChI=1S/C11H20O2.C4H8/c1-4-6-7-8-9-13-11(12)10(3)5-2;1-4(2)3/h3-9H2,1-2H3;1H2,2-3H3 |
| InChIKey | CPUFBIDVIGQYMS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|