C30H51NO2 — CID 159648776
5-ethenyl-2-methylpyridine;octadecyl 2-methylprop-2-enoate (PubChem CID 159648776) has the molecular formula C30H51NO2 and a molecular weight of 457.74 g/mol. Its IUPAC name is 5-ethenyl-2-methylpyridine;octadecyl 2-methylprop-2-enoate.
| Compound Name | 5-ethenyl-2-methylpyridine;octadecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159648776 |
| Molecular Formula | C30H51NO2 |
| Molecular Weight | 457.74 g/mol |
| Exact Mass | 457.39 |
| IUPAC Name | 5-ethenyl-2-methylpyridine;octadecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCCCCCCCCC.C=Cc1ccc(C)nc1 |
| InChI | InChI=1S/C22H42O2.C8H9N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-22(23)21(2)3;1-3-8-5-4-7(2)9-6-8/h2,4-20H2,1,3H3;3-6H,1H2,2H3 |
| InChIKey | MRHKRSBJTNCERC-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.74 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|