C19H20O5S — CID 134503885
2-phenoxyethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate (PubChem CID 134503885) has the molecular formula C19H20O5S and a molecular weight of 360.43 g/mol. Its IUPAC name is 2-phenoxyethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate.
| Compound Name | 2-phenoxyethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate |
|---|---|
| PubChem CID | 134503885 |
| Molecular Formula | C19H20O5S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 2-phenoxyethyl 2-[(4-methylphenyl)sulfonylmethyl]prop-2-enoate |
| SMILES | C=C(CS(=O)(=O)c1ccc(C)cc1)C(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C19H20O5S/c1-15-8-10-18(11-9-15)25(21,22)14-16(2)19(20)24-13-12-23-17-6-4-3-5-7-17/h3-11H,2,12-14H2,1H3 |
| InChIKey | KLUUNCFVKIQVTJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|