C32H37FO6 — CID 144896572
2-fluoro-1,4-dimethylbenzene;bis(2-phenoxyethyl 2-methylprop-2-enoate) (PubChem CID 144896572) has the molecular formula C32H37FO6 and a molecular weight of 536.64 g/mol. Its IUPAC name is 2-fluoro-1,4-dimethylbenzene;bis(2-phenoxyethyl 2-methylprop-2-enoate).
| Compound Name | 2-fluoro-1,4-dimethylbenzene;bis(2-phenoxyethyl 2-methylprop-2-enoate) |
|---|---|
| PubChem CID | 144896572 |
| Molecular Formula | C32H37FO6 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 2-fluoro-1,4-dimethylbenzene;bis(2-phenoxyethyl 2-methylprop-2-enoate) |
| SMILES | C=C(C)C(=O)OCCOc1ccccc1.C=C(C)C(=O)OCCOc1ccccc1.Cc1ccc(C)c(F)c1 |
| InChI | InChI=1S/2C12H14O3.C8H9F/c2*1-10(2)12(13)15-9-8-14-11-6-4-3-5-7-11;1-6-3-4-7(2)8(9)5-6/h2*3-7H,1,8-9H2,2H3;3-5H,1-2H3 |
| InChIKey | CSLHIPQMGNRFCH-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|