C15H27N — CID 636716
(1R,4aR,7R,8aR)-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-amine (PubChem CID 636716) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (1R,4aR,7R,8aR)-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-amine.
| Compound Name | (1R,4aR,7R,8aR)-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 636716 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (1R,4aR,7R,8aR)-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-amine |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C)CCC[C@@](C)(N)[C@@H]2C1 |
| InChI | InChI=1S/C15H27N/c1-11(2)12-6-9-14(3)7-5-8-15(4,16)13(14)10-12/h12-13H,1,5-10,16H2,2-4H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | IEHDMDFZDJQIHW-KBUPBQIOSA-N |
| XLogP | 3.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|