C15H25BrO — CID 163108210
(1R,4R,4aR,7R,8aR)-4-bromo-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ol (PubChem CID 163108210) has the molecular formula C15H25BrO and a molecular weight of 301.27 g/mol. Its IUPAC name is (1R,4R,4aR,7R,8aR)-4-bromo-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ol.
| Compound Name | (1R,4R,4aR,7R,8aR)-4-bromo-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 163108210 |
| Molecular Formula | C15H25BrO |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (1R,4R,4aR,7R,8aR)-4-bromo-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ol |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C)[C@H](Br)CC[C@@](C)(O)[C@@H]2C1 |
| InChI | InChI=1S/C15H25BrO/c1-10(2)11-5-7-14(3)12(9-11)15(4,17)8-6-13(14)16/h11-13,17H,1,5-9H2,2-4H3/t11-,12-,13-,14-,15-/m1/s1 |
| InChIKey | DHDVAVKPPXGHEQ-KJWHEZOQSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|