C16H28NO3+ — CID 59881057
1-[(5R)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]piperidin-1-ium-4-carboxylic acid (PubChem CID 59881057) has the molecular formula C16H28NO3+ and a molecular weight of 282.40 g/mol. Its IUPAC name is 1-[(5R)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]piperidin-1-ium-4-carboxylic acid.
| Compound Name | 1-[(5R)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]piperidin-1-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 59881057 |
| Molecular Formula | C16H28NO3+ |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-[(5R)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]piperidin-1-ium-4-carboxylic acid |
| SMILES | C=C(C)[C@@H]1CCC(C)(O)C([NH+]2CCC(C(=O)O)CC2)C1 |
| InChI | InChI=1S/C16H27NO3/c1-11(2)13-4-7-16(3,20)14(10-13)17-8-5-12(6-9-17)15(18)19/h12-14,20H,1,4-10H2,2-3H3,(H,18,19)/p+1/t13-,14?,16?/m1/s1 |
| InChIKey | VCOKYEZPNIJUMP-VQCLRJIVSA-O |
| XLogP | 0.86 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|