C20H34O2Te — CID 177393311
cis-(1R,4R)-2-[(2R,5R)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]tellanyl-1-methyl-4-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 177393311) has the molecular formula C20H34O2Te and a molecular weight of 434.09 g/mol. Its IUPAC name is cis-(1R,4R)-2-[(2R,5R)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]tellanyl-1-methyl-4-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | cis-(1R,4R)-2-[(2R,5R)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]tellanyl-1-methyl-4-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 177393311 |
| Molecular Formula | C20H34O2Te |
| Molecular Weight | 434.09 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | cis-(1R,4R)-2-[(2R,5R)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]tellanyl-1-methyl-4-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)[C@@H]1CC[C@@](C)(O)C([Te]C2C[C@H](C(=C)C)CC[C@@]2(C)O)C1 |
| InChI | InChI=1S/C20H34O2Te/c1-13(2)15-7-9-19(5,21)17(11-15)23-18-12-16(14(3)4)8-10-20(18,6)22/h15-18,21-22H,1,3,7-12H2,2,4-6H3/t15-,16-,17?,18?,19-,20-/m1/s1 |
| InChIKey | PKGIZHWUFYEVLV-UUMMCEDOSA-N |
| XLogP | 4.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.09 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|