C16H29NO — CID 15906521
(1S,2S,4R)-2-(azepan-1-yl)-1-methyl-4-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 15906521) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (1S,2S,4R)-2-(azepan-1-yl)-1-methyl-4-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | (1S,2S,4R)-2-(azepan-1-yl)-1-methyl-4-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 15906521 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (1S,2S,4R)-2-(azepan-1-yl)-1-methyl-4-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)[C@@H]1CC[C@](C)(O)[C@@H](N2CCCCCC2)C1 |
| InChI | InChI=1S/C16H29NO/c1-13(2)14-8-9-16(3,18)15(12-14)17-10-6-4-5-7-11-17/h14-15,18H,1,4-12H2,2-3H3/t14-,15+,16+/m1/s1 |
| InChIKey | MEFIARYXXLXUBK-PMPSAXMXSA-N |
| XLogP | 3.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|