C15H23Br — CID 163114558
8-bromo-5,8a-dimethyl-3-prop-1-en-2-yl-2,3,4,4a,7,8-hexahydro-1H-naphthalene (PubChem CID 163114558) has the molecular formula C15H23Br and a molecular weight of 283.25 g/mol. Its IUPAC name is 8-bromo-5,8a-dimethyl-3-prop-1-en-2-yl-2,3,4,4a,7,8-hexahydro-1H-naphthalene.
| Compound Name | 8-bromo-5,8a-dimethyl-3-prop-1-en-2-yl-2,3,4,4a,7,8-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 163114558 |
| Molecular Formula | C15H23Br |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 8-bromo-5,8a-dimethyl-3-prop-1-en-2-yl-2,3,4,4a,7,8-hexahydro-1H-naphthalene |
| SMILES | C=C(C)C1CCC2(C)C(Br)CC=C(C)C2C1 |
| InChI | InChI=1S/C15H23Br/c1-10(2)12-7-8-15(4)13(9-12)11(3)5-6-14(15)16/h5,12-14H,1,6-9H2,2-4H3 |
| InChIKey | VRJQKHFNJLBCLC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|