C15H21BrO — CID 11011928
(1S,4aS,7S,8aR)-1-bromo-1,4a-dimethyl-7-prop-1-en-2-yl-6,7,8,8a-tetrahydro-5H-naphthalen-2-one (PubChem CID 11011928) has the molecular formula C15H21BrO and a molecular weight of 297.24 g/mol. Its IUPAC name is (1S,4aS,7S,8aR)-1-bromo-1,4a-dimethyl-7-prop-1-en-2-yl-6,7,8,8a-tetrahydro-5H-naphthalen-2-one.
| Compound Name | (1S,4aS,7S,8aR)-1-bromo-1,4a-dimethyl-7-prop-1-en-2-yl-6,7,8,8a-tetrahydro-5H-naphthalen-2-one |
|---|---|
| PubChem CID | 11011928 |
| Molecular Formula | C15H21BrO |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (1S,4aS,7S,8aR)-1-bromo-1,4a-dimethyl-7-prop-1-en-2-yl-6,7,8,8a-tetrahydro-5H-naphthalen-2-one |
| SMILES | C=C(C)[C@H]1CC[C@@]2(C)C=CC(=O)[C@@](C)(Br)[C@@H]2C1 |
| InChI | InChI=1S/C15H21BrO/c1-10(2)11-5-7-14(3)8-6-13(17)15(4,16)12(14)9-11/h6,8,11-12H,1,5,7,9H2,2-4H3/t11-,12+,14-,15-/m0/s1 |
| InChIKey | ZUULELXRSJILDT-NEBZKDRISA-N |
| XLogP | 4.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|