C20H32O — CID 75220675
4,8a-dimethyl-6-(6-methylhepta-1,5-dien-2-yl)-2,4a,5,6,7,8-hexahydro-1H-naphthalen-1-ol (PubChem CID 75220675) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 4,8a-dimethyl-6-(6-methylhepta-1,5-dien-2-yl)-2,4a,5,6,7,8-hexahydro-1H-naphthalen-1-ol.
| Compound Name | 4,8a-dimethyl-6-(6-methylhepta-1,5-dien-2-yl)-2,4a,5,6,7,8-hexahydro-1H-naphthalen-1-ol |
|---|---|
| PubChem CID | 75220675 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 4,8a-dimethyl-6-(6-methylhepta-1,5-dien-2-yl)-2,4a,5,6,7,8-hexahydro-1H-naphthalen-1-ol |
| SMILES | C=C(CCC=C(C)C)C1CCC2(C)C(O)CC=C(C)C2C1 |
| InChI | InChI=1S/C20H32O/c1-14(2)7-6-8-15(3)17-11-12-20(5)18(13-17)16(4)9-10-19(20)21/h7,9,17-19,21H,3,6,8,10-13H2,1-2,4-5H3 |
| InChIKey | NJRDJVYVVKTPQA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|