C16H28N- — CID 163149049
methyl-[1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexyl]azanide (PubChem CID 163149049) has the molecular formula C16H28N- and a molecular weight of 234.41 g/mol. Its IUPAC name is methyl-[1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexyl]azanide.
| Compound Name | methyl-[1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexyl]azanide |
|---|---|
| PubChem CID | 163149049 |
| Molecular Formula | C16H28N- |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.22 |
| IUPAC Name | methyl-[1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexyl]azanide |
| SMILES | C=C(CCC=C(C)C)C1CCC(C)([N-]C)CC1 |
| InChI | InChI=1S/C16H28N/c1-13(2)7-6-8-14(3)15-9-11-16(4,17-5)12-10-15/h7,15H,3,6,8-12H2,1-2,4-5H3/q-1 |
| InChIKey | NWCWONFABSMMKM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|