C25H42O — CID 162989808
[(1S,4Z,8E,12S)-5,9-dimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-4,8-dien-1-yl]methanol (PubChem CID 162989808) has the molecular formula C25H42O and a molecular weight of 358.61 g/mol. Its IUPAC name is [(1S,4Z,8E,12S)-5,9-dimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-4,8-dien-1-yl]methanol.
| Compound Name | [(1S,4Z,8E,12S)-5,9-dimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-4,8-dien-1-yl]methanol |
|---|---|
| PubChem CID | 162989808 |
| Molecular Formula | C25H42O |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.32 |
| IUPAC Name | [(1S,4Z,8E,12S)-5,9-dimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-4,8-dien-1-yl]methanol |
| SMILES | C=C(CCC=C(C)C)[C@@H]1CC/C(C)=C/CC/C(C)=C\CC[C@H](CO)CC1 |
| InChI | InChI=1S/C25H42O/c1-20(2)9-6-13-23(5)25-17-15-22(4)11-7-10-21(3)12-8-14-24(19-26)16-18-25/h9,11-12,24-26H,5-8,10,13-19H2,1-4H3/b21-12-,22-11+/t24-,25+/m0/s1 |
| InChIKey | DVHRFHOKROCIPF-WDHIMOPQSA-N |
| XLogP | 7.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|