C20H32 — CID 74819495
1,8-dimethyl-4-(6-methylhepta-1,5-dien-2-yl)spiro[4.5]dec-8-ene (PubChem CID 74819495) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is 1,8-dimethyl-4-(6-methylhepta-1,5-dien-2-yl)spiro[4.5]dec-8-ene.
| Compound Name | 1,8-dimethyl-4-(6-methylhepta-1,5-dien-2-yl)spiro[4.5]dec-8-ene |
|---|---|
| PubChem CID | 74819495 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 1,8-dimethyl-4-(6-methylhepta-1,5-dien-2-yl)spiro[4.5]dec-8-ene |
| SMILES | C=C(CCC=C(C)C)C1CCC(C)C12CC=C(C)CC2 |
| InChI | InChI=1S/C20H32/c1-15(2)7-6-8-17(4)19-10-9-18(5)20(19)13-11-16(3)12-14-20/h7,11,18-19H,4,6,8-10,12-14H2,1-3,5H3 |
| InChIKey | REUUHHGDDCLKJR-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|