C16H28O — CID 135296629
(2R)-2-[(1S)-1,4-dimethylcyclohex-3-en-1-yl]-6-methylhept-5-en-2-ol (PubChem CID 135296629) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,4-dimethylcyclohex-3-en-1-yl]-6-methylhept-5-en-2-ol.
| Compound Name | (2R)-2-[(1S)-1,4-dimethylcyclohex-3-en-1-yl]-6-methylhept-5-en-2-ol |
|---|---|
| PubChem CID | 135296629 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (2R)-2-[(1S)-1,4-dimethylcyclohex-3-en-1-yl]-6-methylhept-5-en-2-ol |
| SMILES | CC(C)=CCC[C@@](C)(O)[C@]1(C)CC=C(C)CC1 |
| InChI | InChI=1S/C16H28O/c1-13(2)7-6-10-16(5,17)15(4)11-8-14(3)9-12-15/h7-8,17H,6,9-12H2,1-5H3/t15-,16-/m1/s1 |
| InChIKey | ZERSDKXNSOGPAT-HZPDHXFCSA-N |
| XLogP | 4.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|