C16H28O2 — CID 56847472
(2S)-2-[(2S,5S)-5-ethenyl-2,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-ol (PubChem CID 56847472) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (2S)-2-[(2S,5S)-5-ethenyl-2,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-ol.
| Compound Name | (2S)-2-[(2S,5S)-5-ethenyl-2,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-ol |
|---|---|
| PubChem CID | 56847472 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (2S)-2-[(2S,5S)-5-ethenyl-2,5-dimethyloxolan-2-yl]-6-methylhept-5-en-2-ol |
| SMILES | C=C[C@]1(C)CC[C@@](C)([C@@](C)(O)CCC=C(C)C)O1 |
| InChI | InChI=1S/C16H28O2/c1-7-14(4)11-12-16(6,18-14)15(5,17)10-8-9-13(2)3/h7,9,17H,1,8,10-12H2,2-6H3/t14-,15+,16+/m1/s1 |
| InChIKey | HJAALFNAVJGZJV-PMPSAXMXSA-N |
| XLogP | 4.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|