C15H28O — CID 10966171
4-ethenyl-3-ethyl-4,8-dimethylnon-7-en-3-ol (PubChem CID 10966171) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is 4-ethenyl-3-ethyl-4,8-dimethylnon-7-en-3-ol.
| Compound Name | 4-ethenyl-3-ethyl-4,8-dimethylnon-7-en-3-ol |
|---|---|
| PubChem CID | 10966171 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 4-ethenyl-3-ethyl-4,8-dimethylnon-7-en-3-ol |
| SMILES | C=CC(C)(CCC=C(C)C)C(O)(CC)CC |
| InChI | InChI=1S/C15H28O/c1-7-14(6,12-10-11-13(4)5)15(16,8-2)9-3/h7,11,16H,1,8-10,12H2,2-6H3 |
| InChIKey | CPRMLWYHVQDAFU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|