C20H28O3 — CID 122214979
[4-[(2S,3S)-3-ethenyl-2-hydroxy-3,7-dimethyloct-6-en-2-yl]phenyl] acetate (PubChem CID 122214979) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is [4-[(2S,3S)-3-ethenyl-2-hydroxy-3,7-dimethyloct-6-en-2-yl]phenyl] acetate.
| Compound Name | [4-[(2S,3S)-3-ethenyl-2-hydroxy-3,7-dimethyloct-6-en-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 122214979 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | [4-[(2S,3S)-3-ethenyl-2-hydroxy-3,7-dimethyloct-6-en-2-yl]phenyl] acetate |
| SMILES | C=C[C@](C)(CCC=C(C)C)[C@](C)(O)c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C20H28O3/c1-7-19(5,14-8-9-15(2)3)20(6,22)17-10-12-18(13-11-17)23-16(4)21/h7,9-13,22H,1,8,14H2,2-6H3/t19-,20-/m1/s1 |
| InChIKey | HTDKAOFAUDFFBH-WOJBJXKFSA-N |
| XLogP | 4.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|