C22H28O — CID 122214982
(2S,3S)-3-ethenyl-3,7-dimethyl-2-naphthalen-2-yloct-6-en-2-ol (PubChem CID 122214982) has the molecular formula C22H28O and a molecular weight of 308.47 g/mol. Its IUPAC name is (2S,3S)-3-ethenyl-3,7-dimethyl-2-naphthalen-2-yloct-6-en-2-ol.
| Compound Name | (2S,3S)-3-ethenyl-3,7-dimethyl-2-naphthalen-2-yloct-6-en-2-ol |
|---|---|
| PubChem CID | 122214982 |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | (2S,3S)-3-ethenyl-3,7-dimethyl-2-naphthalen-2-yloct-6-en-2-ol |
| SMILES | C=C[C@](C)(CCC=C(C)C)[C@](C)(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H28O/c1-6-21(4,15-9-10-17(2)3)22(5,23)20-14-13-18-11-7-8-12-19(18)16-20/h6-8,10-14,16,23H,1,9,15H2,2-5H3/t21-,22-/m1/s1 |
| InChIKey | BAHVSMXHRUFRBK-FGZHOGPDSA-N |
| XLogP | 5.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|