C14H12F2O3 — CID 62398445
2,2-difluoro-3-hydroxy-3-naphthalen-2-ylbutanoic acid (PubChem CID 62398445) has the molecular formula C14H12F2O3 and a molecular weight of 266.24 g/mol. Its IUPAC name is 2,2-difluoro-3-hydroxy-3-naphthalen-2-ylbutanoic acid.
| Compound Name | 2,2-difluoro-3-hydroxy-3-naphthalen-2-ylbutanoic acid |
|---|---|
| PubChem CID | 62398445 |
| Molecular Formula | C14H12F2O3 |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2,2-difluoro-3-hydroxy-3-naphthalen-2-ylbutanoic acid |
| SMILES | CC(O)(c1ccc2ccccc2c1)C(F)(F)C(=O)O |
| InChI | InChI=1S/C14H12F2O3/c1-13(19,14(15,16)12(17)18)11-7-6-9-4-2-3-5-10(9)8-11/h2-8,19H,1H3,(H,17,18) |
| InChIKey | QDJXDMFSNSJXLR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |