C14H18F2O3 — CID 62398242
3-(4-tert-butylphenyl)-2,2-difluoro-3-hydroxybutanoic acid (PubChem CID 62398242) has the molecular formula C14H18F2O3 and a molecular weight of 272.29 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-2,2-difluoro-3-hydroxybutanoic acid.
| Compound Name | 3-(4-tert-butylphenyl)-2,2-difluoro-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 62398242 |
| Molecular Formula | C14H18F2O3 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3-(4-tert-butylphenyl)-2,2-difluoro-3-hydroxybutanoic acid |
| SMILES | CC(C)(C)c1ccc(C(C)(O)C(F)(F)C(=O)O)cc1 |
| InChI | InChI=1S/C14H18F2O3/c1-12(2,3)9-5-7-10(8-6-9)13(4,19)14(15,16)11(17)18/h5-8,19H,1-4H3,(H,17,18) |
| InChIKey | IBCHRUKPIFAVDN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |