C18H13F2NO — CID 102584722
2,2-difluoro-2-naphthalen-2-yl-N-phenylacetamide (PubChem CID 102584722) has the molecular formula C18H13F2NO and a molecular weight of 297.30 g/mol. Its IUPAC name is 2,2-difluoro-2-naphthalen-2-yl-N-phenylacetamide.
| Compound Name | 2,2-difluoro-2-naphthalen-2-yl-N-phenylacetamide |
|---|---|
| PubChem CID | 102584722 |
| Molecular Formula | C18H13F2NO |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2,2-difluoro-2-naphthalen-2-yl-N-phenylacetamide |
| SMILES | O=C(Nc1ccccc1)C(F)(F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H13F2NO/c19-18(20,17(22)21-16-8-2-1-3-9-16)15-11-10-13-6-4-5-7-14(13)12-15/h1-12H,(H,21,22) |
| InChIKey | FSJOWIFXWYVHKQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |